C16H18F3N3O3 — CID 21003748
6-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]hexanoic acid (PubChem CID 21003748) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 6-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]hexanoic acid.
| Compound Name | 6-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 21003748 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 6-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]hexanoic acid |
| SMILES | COc1ccc2c(NCCCCCC(=O)O)nc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C16H18F3N3O3/c1-25-10-6-7-11-12(9-10)21-15(16(17,18)19)22-14(11)20-8-4-2-3-5-13(23)24/h6-7,9H,2-5,8H2,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | LVRGJULFIUXYSB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|