C16H20ClN3O4 — CID 22693111
6-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]hexanoic acid (PubChem CID 22693111) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is 6-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]hexanoic acid.
| Compound Name | 6-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 22693111 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 6-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]hexanoic acid |
| SMILES | COc1cc2nc(Cl)nc(NCCCCCC(=O)O)c2cc1OC |
| InChI | InChI=1S/C16H20ClN3O4/c1-23-12-8-10-11(9-13(12)24-2)19-16(17)20-15(10)18-7-5-3-4-6-14(21)22/h8-9H,3-7H2,1-2H3,(H,21,22)(H,18,19,20) |
| InChIKey | UDUCVEJRHCPQMO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|