C16H19ClN2O4 — CID 151134940
2-(butylamino)-4-chloro-6,7-dimethoxyquinoline-3-carboxylic acid (PubChem CID 151134940) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 2-(butylamino)-4-chloro-6,7-dimethoxyquinoline-3-carboxylic acid.
| Compound Name | 2-(butylamino)-4-chloro-6,7-dimethoxyquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 151134940 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(butylamino)-4-chloro-6,7-dimethoxyquinoline-3-carboxylic acid |
| SMILES | CCCCNc1nc2cc(OC)c(OC)cc2c(Cl)c1C(=O)O |
| InChI | InChI=1S/C16H19ClN2O4/c1-4-5-6-18-15-13(16(20)21)14(17)9-7-11(22-2)12(23-3)8-10(9)19-15/h7-8H,4-6H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | MUZZUVUJTPQWSX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|