2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid

C12H18N2O2 — CID 60678719

IUPAC2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid
SMILESCCCCNc1nc(C)cc(C)c1C(=O)O
InChIInChI=1S/C12H18N2O2/c1-4-5-6-13-11-10(12(15)16)8(2)7-9(3)14-11/h7H,4-6H2,1-3H3,(H,13,14)(H,15,16)
InChIKeyUOOVKTVAEYCWJL-UHFFFAOYSA-N
MW222.29 g/mol
LogP2.61
Rot. Bonds5

About 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid

2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid (PubChem CID 60678719) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid
PubChem CID60678719
Molecular FormulaC12H18N2O2
Molecular Weight222.29 g/mol
Exact Mass222.14
IUPAC Name2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid
SMILESCCCCNc1nc(C)cc(C)c1C(=O)O
InChIInChI=1S/C12H18N2O2/c1-4-5-6-13-11-10(12(15)16)8(2)7-9(3)14-11/h7H,4-6H2,1-3H3,(H,13,14)(H,15,16)
InChIKeyUOOVKTVAEYCWJL-UHFFFAOYSA-N
XLogP2.61
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.29
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid (CID 60678719) is 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid is CCCCNc1nc(C)cc(C)c1C(=O)O.
What is the InChIKey of 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is UOOVKTVAEYCWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-4-5-6-13-11-10(12(15)16)8(2)7-9(3)14-11/h7H,4-6H2,1-3H3,(H,13,14)(H,15,16).
What are the key properties of 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid?
2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 222.29 g/mol, XLogP of 2.61, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)-4,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 60678719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).