C23H39N5O2 — CID 171853001
7-(2-aminoethoxy)-2-N,4-N-dihexyl-6-methoxyquinazoline-2,4-diamine (PubChem CID 171853001) has the molecular formula C23H39N5O2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 7-(2-aminoethoxy)-2-N,4-N-dihexyl-6-methoxyquinazoline-2,4-diamine.
| Compound Name | 7-(2-aminoethoxy)-2-N,4-N-dihexyl-6-methoxyquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 171853001 |
| Molecular Formula | C23H39N5O2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | 7-(2-aminoethoxy)-2-N,4-N-dihexyl-6-methoxyquinazoline-2,4-diamine |
| SMILES | CCCCCCNc1nc(NCCCCCC)c2cc(OC)c(OCCN)cc2n1 |
| InChI | InChI=1S/C23H39N5O2/c1-4-6-8-10-13-25-22-18-16-20(29-3)21(30-15-12-24)17-19(18)27-23(28-22)26-14-11-9-7-5-2/h16-17H,4-15,24H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | PPQMLMAHAVBLBV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|