ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate

C13H13ClN2O4 — CID 67083777

IUPACethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate
SMILESCCOC(=O)c1nnc2cc(OC)c(OC)cc2c1Cl
InChIInChI=1S/C13H13ClN2O4/c1-4-20-13(17)12-11(14)7-5-9(18-2)10(19-3)6-8(7)15-16-12/h5-6H,4H2,1-3H3
InChIKeyRQBSZJAYRQWXIY-UHFFFAOYSA-N
MW296.71 g/mol
LogP2.48
Rot. Bonds4

About ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate

ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate (PubChem CID 67083777) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate.

Molecular Properties

Compound Nameethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate
PubChem CID67083777
Molecular FormulaC13H13ClN2O4
Molecular Weight296.71 g/mol
Exact Mass296.06
IUPAC Nameethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate
SMILESCCOC(=O)c1nnc2cc(OC)c(OC)cc2c1Cl
InChIInChI=1S/C13H13ClN2O4/c1-4-20-13(17)12-11(14)7-5-9(18-2)10(19-3)6-8(7)15-16-12/h5-6H,4H2,1-3H3
InChIKeyRQBSZJAYRQWXIY-UHFFFAOYSA-N
XLogP2.48
TPSA70.54 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.71
LogP ≤ 52.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate?
The IUPAC name of ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate (CID 67083777) is ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate.
What is the SMILES notation for ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate?
The canonical SMILES for ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate is CCOC(=O)c1nnc2cc(OC)c(OC)cc2c1Cl.
What is the InChIKey of ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate?
The InChIKey is RQBSZJAYRQWXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O4/c1-4-20-13(17)12-11(14)7-5-9(18-2)10(19-3)6-8(7)15-16-12/h5-6H,4H2,1-3H3.
What are the key properties of ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate?
ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate has a molecular weight of 296.71 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-6,7-dimethoxycinnoline-3-carboxylate is sourced from PubChem (CID 67083777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).