C24H26BrNO6 — CID 11799673
ethyl 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate (PubChem CID 11799673) has the molecular formula C24H26BrNO6 and a molecular weight of 504.38 g/mol. Its IUPAC name is ethyl 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate.
| Compound Name | ethyl 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11799673 |
| Molecular Formula | C24H26BrNO6 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | ethyl 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(CCBr)nc2cc(OC)c(OC)cc2c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H26BrNO6/c1-6-32-24(27)23-16(9-10-25)26-17-13-21(31-5)20(30-4)12-15(17)22(23)14-7-8-18(28-2)19(11-14)29-3/h7-8,11-13H,6,9-10H2,1-5H3 |
| InChIKey | OQCGVPDWPMIXER-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|