C22H25NO5 — CID 22097659
[4-(3,4-dimethoxyphenyl)-2-ethyl-6,7-dimethoxyquinolin-3-yl]methanol (PubChem CID 22097659) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)-2-ethyl-6,7-dimethoxyquinolin-3-yl]methanol.
| Compound Name | [4-(3,4-dimethoxyphenyl)-2-ethyl-6,7-dimethoxyquinolin-3-yl]methanol |
|---|---|
| PubChem CID | 22097659 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)-2-ethyl-6,7-dimethoxyquinolin-3-yl]methanol |
| SMILES | CCc1nc2cc(OC)c(OC)cc2c(-c2ccc(OC)c(OC)c2)c1CO |
| InChI | InChI=1S/C22H25NO5/c1-6-16-15(12-24)22(13-7-8-18(25-2)19(9-13)26-3)14-10-20(27-4)21(28-5)11-17(14)23-16/h7-11,24H,6,12H2,1-5H3 |
| InChIKey | YMVHTYVZPSFZKP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |