C25H28BrNO5 — CID 19039881
1-[2-(bromomethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinolin-3-yl]pentan-1-one (PubChem CID 19039881) has the molecular formula C25H28BrNO5 and a molecular weight of 502.41 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinolin-3-yl]pentan-1-one.
| Compound Name | 1-[2-(bromomethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinolin-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 19039881 |
| Molecular Formula | C25H28BrNO5 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 1-[2-(bromomethyl)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinolin-3-yl]pentan-1-one |
| SMILES | CCCCC(=O)c1c(CBr)nc2cc(OC)c(OC)cc2c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H28BrNO5/c1-6-7-8-19(28)25-18(14-26)27-17-13-23(32-5)22(31-4)12-16(17)24(25)15-9-10-20(29-2)21(11-15)30-3/h9-13H,6-8,14H2,1-5H3 |
| InChIKey | NBWLKXGZWNCFAT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|