C13H17BrO3 — CID 43161105
1-(2-bromo-4,5-dimethoxyphenyl)pentan-1-one (PubChem CID 43161105) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)pentan-1-one.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 43161105 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)pentan-1-one |
| SMILES | CCCCC(=O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C13H17BrO3/c1-4-5-6-11(15)9-7-12(16-2)13(17-3)8-10(9)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | IEGACZHAUMGPIK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |