C28H48O3 — CID 71424697
1-(2-decyl-4,5-dimethoxyphenyl)decan-1-one (PubChem CID 71424697) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is 1-(2-decyl-4,5-dimethoxyphenyl)decan-1-one.
| Compound Name | 1-(2-decyl-4,5-dimethoxyphenyl)decan-1-one |
|---|---|
| PubChem CID | 71424697 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | 1-(2-decyl-4,5-dimethoxyphenyl)decan-1-one |
| SMILES | CCCCCCCCCCc1cc(OC)c(OC)cc1C(=O)CCCCCCCCC |
| InChI | InChI=1S/C28H48O3/c1-5-7-9-11-13-15-16-18-20-24-22-27(30-3)28(31-4)23-25(24)26(29)21-19-17-14-12-10-8-6-2/h22-23H,5-21H2,1-4H3 |
| InChIKey | FVUFGKLCGWDIIJ-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|