C24H34O5 — CID 10834959
1-(1,4,5,8-tetramethoxynaphthalen-2-yl)decan-1-one (PubChem CID 10834959) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is 1-(1,4,5,8-tetramethoxynaphthalen-2-yl)decan-1-one.
| Compound Name | 1-(1,4,5,8-tetramethoxynaphthalen-2-yl)decan-1-one |
|---|---|
| PubChem CID | 10834959 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1-(1,4,5,8-tetramethoxynaphthalen-2-yl)decan-1-one |
| SMILES | CCCCCCCCCC(=O)c1cc(OC)c2c(OC)ccc(OC)c2c1OC |
| InChI | InChI=1S/C24H34O5/c1-6-7-8-9-10-11-12-13-18(25)17-16-21(28-4)22-19(26-2)14-15-20(27-3)23(22)24(17)29-5/h14-16H,6-13H2,1-5H3 |
| InChIKey | UOHFZPPUYOXBIK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|