C26H39NO5 — CID 142629347
N-propoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)nonan-1-imine (PubChem CID 142629347) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is N-propoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)nonan-1-imine.
| Compound Name | N-propoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)nonan-1-imine |
|---|---|
| PubChem CID | 142629347 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N-propoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)nonan-1-imine |
| SMILES | CCCCCCCCC(=NOCCC)c1cc(OC)c2c(OC)ccc(OC)c2c1OC |
| InChI | InChI=1S/C26H39NO5/c1-7-9-10-11-12-13-14-20(27-32-17-8-2)19-18-23(30-5)24-21(28-3)15-16-22(29-4)25(24)26(19)31-6/h15-16,18H,7-14,17H2,1-6H3 |
| InChIKey | LMHLHDNYQDOILB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|