C26H37NO5 — CID 10551239
6-[(E)-C-decyl-N-propoxycarbonimidoyl]-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 10551239) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is 6-[(E)-C-decyl-N-propoxycarbonimidoyl]-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 6-[(E)-C-decyl-N-propoxycarbonimidoyl]-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10551239 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 6-[(E)-C-decyl-N-propoxycarbonimidoyl]-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCCCCCCCCC/C(=N\OCCC)c1cc(OC)c2c(c1OC)C(=O)C=CC2=O |
| InChI | InChI=1S/C26H37NO5/c1-5-7-8-9-10-11-12-13-14-20(27-32-17-6-2)19-18-23(30-3)24-21(28)15-16-22(29)25(24)26(19)31-4/h15-16,18H,5-14,17H2,1-4H3/b27-20+ |
| InChIKey | HEJKHVYFWUVIEK-NHFJDJAPSA-N |
| XLogP | 6.30 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|