C19H23NO5 — CID 86206538
6-(C-hexyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 86206538) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 6-(C-hexyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 6-(C-hexyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 86206538 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 6-(C-hexyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCCCCCC(=NO)c1cc(OC)c2c(c1OC)C(=O)C=CC2=O |
| InChI | InChI=1S/C19H23NO5/c1-4-5-6-7-8-13(20-23)12-11-16(24-2)17-14(21)9-10-15(22)18(17)19(12)25-3/h9-11,23H,4-8H2,1-3H3 |
| InChIKey | FKBSRNIEUJMJJY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|