C25H35NO5 — CID 177424672
5,8-dimethoxy-6-[(Z)-C-nonyl-N-propoxycarbonimidoyl]naphthalene-1,4-dione (PubChem CID 177424672) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is 5,8-dimethoxy-6-[(Z)-C-nonyl-N-propoxycarbonimidoyl]naphthalene-1,4-dione.
| Compound Name | 5,8-dimethoxy-6-[(Z)-C-nonyl-N-propoxycarbonimidoyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 177424672 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 5,8-dimethoxy-6-[(Z)-C-nonyl-N-propoxycarbonimidoyl]naphthalene-1,4-dione |
| SMILES | CCCCCCCCC/C(=N/OCCC)c1cc(OC)c2c(c1OC)C(=O)C=CC2=O |
| InChI | InChI=1S/C25H35NO5/c1-5-7-8-9-10-11-12-13-19(26-31-16-6-2)18-17-22(29-3)23-20(27)14-15-21(28)24(23)25(18)30-4/h14-15,17H,5-13,16H2,1-4H3/b26-19- |
| InChIKey | VPYBKMVNDNYDGA-XHPQRKPJSA-N |
| XLogP | 5.91 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|