C25H34O6 — CID 11004512
1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)heptyl hexanoate (PubChem CID 11004512) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)heptyl hexanoate.
| Compound Name | 1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)heptyl hexanoate |
|---|---|
| PubChem CID | 11004512 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)heptyl hexanoate |
| SMILES | CCCCCCC(OC(=O)CCCCC)c1cc(OC)c2c(c1OC)C(=O)C=CC2=O |
| InChI | InChI=1S/C25H34O6/c1-5-7-9-11-12-20(31-22(28)13-10-8-6-2)17-16-21(29-3)23-18(26)14-15-19(27)24(23)25(17)30-4/h14-16,20H,5-13H2,1-4H3 |
| InChIKey | ZZJAZDNNRFTJOV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|