C17H18O6 — CID 14083913
6-(1-hydroxy-4-oxopentyl)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 14083913) has the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. Its IUPAC name is 6-(1-hydroxy-4-oxopentyl)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 6-(1-hydroxy-4-oxopentyl)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 14083913 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 6-(1-hydroxy-4-oxopentyl)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | COc1cc(C(O)CCC(C)=O)c(OC)c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C17H18O6/c1-9(18)4-5-11(19)10-8-14(22-2)15-12(20)6-7-13(21)16(15)17(10)23-3/h6-8,11,19H,4-5H2,1-3H3 |
| InChIKey | MOTXGUSQEWCOGI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|