C21H18O6 — CID 102023640
[(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-phenylmethyl] acetate (PubChem CID 102023640) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-phenylmethyl] acetate.
| Compound Name | [(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-phenylmethyl] acetate |
|---|---|
| PubChem CID | 102023640 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [(1,4-dimethoxy-5,8-dioxonaphthalen-2-yl)-phenylmethyl] acetate |
| SMILES | COc1cc(C(OC(C)=O)c2ccccc2)c(OC)c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C21H18O6/c1-12(22)27-20(13-7-5-4-6-8-13)14-11-17(25-2)18-15(23)9-10-16(24)19(18)21(14)26-3/h4-11,20H,1-3H3 |
| InChIKey | WKLHIUSMMZXFAN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|