C20H26O7S — CID 175322275
6-(1-ethylsulfonyl-4-hydroxy-3,3-dimethylbutyl)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 175322275) has the molecular formula C20H26O7S and a molecular weight of 410.49 g/mol. Its IUPAC name is 6-(1-ethylsulfonyl-4-hydroxy-3,3-dimethylbutyl)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 6-(1-ethylsulfonyl-4-hydroxy-3,3-dimethylbutyl)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 175322275 |
| Molecular Formula | C20H26O7S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 6-(1-ethylsulfonyl-4-hydroxy-3,3-dimethylbutyl)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCS(=O)(=O)C(CC(C)(C)CO)c1cc(OC)c2c(c1OC)C(=O)C=CC2=O |
| InChI | InChI=1S/C20H26O7S/c1-6-28(24,25)16(10-20(2,3)11-21)12-9-15(26-4)17-13(22)7-8-14(23)18(17)19(12)27-5/h7-9,16,21H,6,10-11H2,1-5H3 |
| InChIKey | JLLGHOCMKIKSAK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|