C15H15NO5 — CID 85240408
6-(C-ethyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 85240408) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 6-(C-ethyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 6-(C-ethyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 85240408 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 6-(C-ethyl-N-hydroxycarbonimidoyl)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | CCC(=NO)c1cc(OC)c2c(c1OC)C(=O)C=CC2=O |
| InChI | InChI=1S/C15H15NO5/c1-4-9(16-19)8-7-12(20-2)13-10(17)5-6-11(18)14(13)15(8)21-3/h5-7,19H,4H2,1-3H3 |
| InChIKey | LXUWVDLLQGPISS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|