C18H21N3O4 — CID 86205895
6-(1-azido-4-methylpentyl)-5,8-dimethoxynaphthalene-1,4-dione (PubChem CID 86205895) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 6-(1-azido-4-methylpentyl)-5,8-dimethoxynaphthalene-1,4-dione.
| Compound Name | 6-(1-azido-4-methylpentyl)-5,8-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 86205895 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 6-(1-azido-4-methylpentyl)-5,8-dimethoxynaphthalene-1,4-dione |
| SMILES | COc1cc(C(CCC(C)C)N=[N+]=[N-])c(OC)c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C18H21N3O4/c1-10(2)5-6-12(20-21-19)11-9-15(24-3)16-13(22)7-8-14(23)17(16)18(11)25-4/h7-10,12H,5-6H2,1-4H3 |
| InChIKey | TUAKEDINSDUZAJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|