C19H25N3O4 — CID 142629366
2-(1-azidopentyl)-1,4,5,8-tetramethoxynaphthalene (PubChem CID 142629366) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(1-azidopentyl)-1,4,5,8-tetramethoxynaphthalene.
| Compound Name | 2-(1-azidopentyl)-1,4,5,8-tetramethoxynaphthalene |
|---|---|
| PubChem CID | 142629366 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-(1-azidopentyl)-1,4,5,8-tetramethoxynaphthalene |
| SMILES | CCCCC(N=[N+]=[N-])c1cc(OC)c2c(OC)ccc(OC)c2c1OC |
| InChI | InChI=1S/C19H25N3O4/c1-6-7-8-13(21-22-20)12-11-16(25-4)17-14(23-2)9-10-15(24-3)18(17)19(12)26-5/h9-11,13H,6-8H2,1-5H3 |
| InChIKey | JDTUWJFUFGTGEB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|