C20H26O4S — CID 42604877
4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-ene-1-thiol (PubChem CID 42604877) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is 4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-ene-1-thiol.
| Compound Name | 4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-ene-1-thiol |
|---|---|
| PubChem CID | 42604877 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-ene-1-thiol |
| SMILES | COc1ccc(OC)c2c(OC)c(C(S)CC=C(C)C)cc(OC)c12 |
| InChI | InChI=1S/C20H26O4S/c1-12(2)7-10-17(25)13-11-16(23-5)18-14(21-3)8-9-15(22-4)19(18)20(13)24-6/h7-9,11,17,25H,10H2,1-6H3 |
| InChIKey | WZZCDAGDPIWYDQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|