C20H26O5 — CID 118539077
(1S)-4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-ol (PubChem CID 118539077) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1S)-4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-ol.
| Compound Name | (1S)-4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-ol |
|---|---|
| PubChem CID | 118539077 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S)-4-methyl-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-ol |
| SMILES | COc1ccc(OC)c2c(OC)c([C@@H](O)CC=C(C)C)cc(OC)c12 |
| InChI | InChI=1S/C20H26O5/c1-12(2)7-8-14(21)13-11-17(24-5)18-15(22-3)9-10-16(23-4)19(18)20(13)25-6/h7,9-11,14,21H,8H2,1-6H3/t14-/m0/s1 |
| InChIKey | JATZDQLMBLHKFK-AWEZNQCLSA-N |
| XLogP | 4.26 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|