C22H26O5 — CID 142627073
1-(1,4,5,8-tetramethoxyanthracen-2-yl)butan-1-ol (PubChem CID 142627073) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(1,4,5,8-tetramethoxyanthracen-2-yl)butan-1-ol.
| Compound Name | 1-(1,4,5,8-tetramethoxyanthracen-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 142627073 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(1,4,5,8-tetramethoxyanthracen-2-yl)butan-1-ol |
| SMILES | CCCC(O)c1cc(OC)c2cc3c(OC)ccc(OC)c3cc2c1OC |
| InChI | InChI=1S/C22H26O5/c1-6-7-18(23)17-12-21(26-4)15-10-13-14(11-16(15)22(17)27-5)20(25-3)9-8-19(13)24-2/h8-12,18,23H,6-7H2,1-5H3 |
| InChIKey | FWNNKHLPPCRQSA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|