C27H42O5 — CID 21468102
2-(1-heptoxy-4-methylpentyl)-1,4,5,8-tetramethoxynaphthalene (PubChem CID 21468102) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is 2-(1-heptoxy-4-methylpentyl)-1,4,5,8-tetramethoxynaphthalene.
| Compound Name | 2-(1-heptoxy-4-methylpentyl)-1,4,5,8-tetramethoxynaphthalene |
|---|---|
| PubChem CID | 21468102 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 2-(1-heptoxy-4-methylpentyl)-1,4,5,8-tetramethoxynaphthalene |
| SMILES | CCCCCCCOC(CCC(C)C)c1cc(OC)c2c(OC)ccc(OC)c2c1OC |
| InChI | InChI=1S/C27H42O5/c1-8-9-10-11-12-17-32-21(14-13-19(2)3)20-18-24(30-6)25-22(28-4)15-16-23(29-5)26(25)27(20)31-7/h15-16,18-19,21H,8-14,17H2,1-7H3 |
| InChIKey | AQQSFAXOVJUXEE-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|