C27H31NO5 — CID 141167060
4-methyl-N-phenylmethoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-imine (PubChem CID 141167060) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-methyl-N-phenylmethoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-imine.
| Compound Name | 4-methyl-N-phenylmethoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-imine |
|---|---|
| PubChem CID | 141167060 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-methyl-N-phenylmethoxy-1-(1,4,5,8-tetramethoxynaphthalen-2-yl)pent-3-en-1-imine |
| SMILES | COc1ccc(OC)c2c(OC)c(C(CC=C(C)C)=NOCc3ccccc3)cc(OC)c12 |
| InChI | InChI=1S/C27H31NO5/c1-18(2)12-13-21(28-33-17-19-10-8-7-9-11-19)20-16-24(31-5)25-22(29-3)14-15-23(30-4)26(25)27(20)32-6/h7-12,14-16H,13,17H2,1-6H3 |
| InChIKey | XWPVHMKDXAMRFI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|