C22H26O7 — CID 141292091
[4-acetyloxy-3-(1-hydroxy-4-methylpent-3-enyl)-5,8-dimethoxynaphthalen-1-yl] acetate (PubChem CID 141292091) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [4-acetyloxy-3-(1-hydroxy-4-methylpent-3-enyl)-5,8-dimethoxynaphthalen-1-yl] acetate.
| Compound Name | [4-acetyloxy-3-(1-hydroxy-4-methylpent-3-enyl)-5,8-dimethoxynaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 141292091 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [4-acetyloxy-3-(1-hydroxy-4-methylpent-3-enyl)-5,8-dimethoxynaphthalen-1-yl] acetate |
| SMILES | COc1ccc(OC)c2c(OC(C)=O)c(C(O)CC=C(C)C)cc(OC(C)=O)c12 |
| InChI | InChI=1S/C22H26O7/c1-12(2)7-8-16(25)15-11-19(28-13(3)23)20-17(26-5)9-10-18(27-6)21(20)22(15)29-14(4)24/h7,9-11,16,25H,8H2,1-6H3 |
| InChIKey | JUMMMGBSXGTALE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|