C18H20O6 — CID 11724307
ethyl 4-acetyloxy-5,8-dimethoxy-1-methylnaphthalene-2-carboxylate (PubChem CID 11724307) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is ethyl 4-acetyloxy-5,8-dimethoxy-1-methylnaphthalene-2-carboxylate.
| Compound Name | ethyl 4-acetyloxy-5,8-dimethoxy-1-methylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11724307 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 4-acetyloxy-5,8-dimethoxy-1-methylnaphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2c(OC)ccc(OC)c2c1C |
| InChI | InChI=1S/C18H20O6/c1-6-23-18(20)12-9-15(24-11(3)19)17-14(22-5)8-7-13(21-4)16(17)10(12)2/h7-9H,6H2,1-5H3 |
| InChIKey | RBLBFXXWCRSWFH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|