C21H26N2O6 — CID 118539093
[(1S)-1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enyl] propanoate (PubChem CID 118539093) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is [(1S)-1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enyl] propanoate.
| Compound Name | [(1S)-1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enyl] propanoate |
|---|---|
| PubChem CID | 118539093 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [(1S)-1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-4-methylpent-3-enyl] propanoate |
| SMILES | CCC(=O)O[C@@H](CC=C(C)C)c1cc(OC)c2c(NO)ccc(N=O)c2c1OC |
| InChI | InChI=1S/C21H26N2O6/c1-6-18(24)29-16(10-7-12(2)3)13-11-17(27-4)19-14(22-25)8-9-15(23-26)20(19)21(13)28-5/h7-9,11,16,22,25H,6,10H2,1-5H3/t16-/m0/s1 |
| InChIKey | KQQRRSFIIMFZIJ-INIZCTEOSA-N |
| XLogP | 5.41 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|