C10H13NO4 — CID 88927442
1-(4,5-dimethoxy-2-nitrosophenyl)ethanol (PubChem CID 88927442) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrosophenyl)ethanol.
| Compound Name | 1-(4,5-dimethoxy-2-nitrosophenyl)ethanol |
|---|---|
| PubChem CID | 88927442 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrosophenyl)ethanol |
| SMILES | COc1cc(N=O)c(C(C)O)cc1OC |
| InChI | InChI=1S/C10H13NO4/c1-6(12)7-4-9(14-2)10(15-3)5-8(7)11-13/h4-6,12H,1-3H3 |
| InChIKey | YECKCVGQWVVLCT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |