C11H15ClO4 — CID 84705859
1-(3-chloro-2,4,5-trimethoxyphenyl)ethanol (PubChem CID 84705859) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is 1-(3-chloro-2,4,5-trimethoxyphenyl)ethanol.
| Compound Name | 1-(3-chloro-2,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 84705859 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-(3-chloro-2,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(C(C)O)c(OC)c(Cl)c1OC |
| InChI | InChI=1S/C11H15ClO4/c1-6(13)7-5-8(14-2)11(16-4)9(12)10(7)15-3/h5-6,13H,1-4H3 |
| InChIKey | SQZLKIULDYUYSB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |