C14H22ClNO4 — CID 103377157
3-[2-amino-1-(2-chloro-3,4-dimethoxyphenyl)ethoxy]butan-2-ol (PubChem CID 103377157) has the molecular formula C14H22ClNO4 and a molecular weight of 303.79 g/mol. Its IUPAC name is 3-[2-amino-1-(2-chloro-3,4-dimethoxyphenyl)ethoxy]butan-2-ol.
| Compound Name | 3-[2-amino-1-(2-chloro-3,4-dimethoxyphenyl)ethoxy]butan-2-ol |
|---|---|
| PubChem CID | 103377157 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-[2-amino-1-(2-chloro-3,4-dimethoxyphenyl)ethoxy]butan-2-ol |
| SMILES | COc1ccc(C(CN)OC(C)C(C)O)c(Cl)c1OC |
| InChI | InChI=1S/C14H22ClNO4/c1-8(17)9(2)20-12(7-16)10-5-6-11(18-3)14(19-4)13(10)15/h5-6,8-9,12,17H,7,16H2,1-4H3 |
| InChIKey | VBARUSYXNCSTGM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |