C15H25NO5 — CID 103377036
3-[2-amino-1-(3,4,5-trimethoxyphenyl)ethoxy]butan-2-ol (PubChem CID 103377036) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[2-amino-1-(3,4,5-trimethoxyphenyl)ethoxy]butan-2-ol.
| Compound Name | 3-[2-amino-1-(3,4,5-trimethoxyphenyl)ethoxy]butan-2-ol |
|---|---|
| PubChem CID | 103377036 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-[2-amino-1-(3,4,5-trimethoxyphenyl)ethoxy]butan-2-ol |
| SMILES | COc1cc(C(CN)OC(C)C(C)O)cc(OC)c1OC |
| InChI | InChI=1S/C15H25NO5/c1-9(17)10(2)21-14(8-16)11-6-12(18-3)15(20-5)13(7-11)19-4/h6-7,9-10,14,17H,8,16H2,1-5H3 |
| InChIKey | HIXPPTGJADZYGH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |