C14H22ClNO3 — CID 63630961
2-amino-1-(2-chloro-3,4-dimethoxyphenyl)-4-methylpentan-1-ol (PubChem CID 63630961) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-3,4-dimethoxyphenyl)-4-methylpentan-1-ol.
| Compound Name | 2-amino-1-(2-chloro-3,4-dimethoxyphenyl)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 63630961 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-amino-1-(2-chloro-3,4-dimethoxyphenyl)-4-methylpentan-1-ol |
| SMILES | COc1ccc(C(O)C(N)CC(C)C)c(Cl)c1OC |
| InChI | InChI=1S/C14H22ClNO3/c1-8(2)7-10(16)13(17)9-5-6-11(18-3)14(19-4)12(9)15/h5-6,8,10,13,17H,7,16H2,1-4H3 |
| InChIKey | VMJUYSJQRSNRRJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |