C10H12ClF2NO2 — CID 171247035
(1S)-1-(2-chloro-3,4-dimethoxyphenyl)-2,2-difluoroethanamine (PubChem CID 171247035) has the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3,4-dimethoxyphenyl)-2,2-difluoroethanamine.
| Compound Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 171247035 |
| Molecular Formula | C10H12ClF2NO2 |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)-2,2-difluoroethanamine |
| SMILES | COc1ccc([C@H](N)C(F)F)c(Cl)c1OC |
| InChI | InChI=1S/C10H12ClF2NO2/c1-15-6-4-3-5(8(14)10(12)13)7(11)9(6)16-2/h3-4,8,10H,14H2,1-2H3/t8-/m0/s1 |
| InChIKey | HFZLZPGJFDODNV-QMMMGPOBSA-N |
| XLogP | 2.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |