C12H15ClF3NO2 — CID 171202005
(1R)-1-(2-chloro-3,4-dimethoxyphenyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 171202005) has the molecular formula C12H15ClF3NO2 and a molecular weight of 297.70 g/mol. Its IUPAC name is (1R)-1-(2-chloro-3,4-dimethoxyphenyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | (1R)-1-(2-chloro-3,4-dimethoxyphenyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 171202005 |
| Molecular Formula | C12H15ClF3NO2 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (1R)-1-(2-chloro-3,4-dimethoxyphenyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | COc1ccc([C@H](N)CCC(F)(F)F)c(Cl)c1OC |
| InChI | InChI=1S/C12H15ClF3NO2/c1-18-9-4-3-7(10(13)11(9)19-2)8(17)5-6-12(14,15)16/h3-4,8H,5-6,17H2,1-2H3/t8-/m1/s1 |
| InChIKey | DTVHLZXHZBWQRN-MRVPVSSYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |