C13H18ClNO2 — CID 171221566
(1S)-1-(2-chloro-3,4-dimethoxyphenyl)pent-4-en-1-amine (PubChem CID 171221566) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3,4-dimethoxyphenyl)pent-4-en-1-amine.
| Compound Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 171221566 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (1S)-1-(2-chloro-3,4-dimethoxyphenyl)pent-4-en-1-amine |
| SMILES | C=CCC[C@H](N)c1ccc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C13H18ClNO2/c1-4-5-6-10(15)9-7-8-11(16-2)13(17-3)12(9)14/h4,7-8,10H,1,5-6,15H2,2-3H3/t10-/m0/s1 |
| InChIKey | BGQAINCZJFSEED-JTQLQIEISA-N |
| XLogP | 3.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|