C13H20O5 — CID 162953882
2-methoxy-1-(2,4,5-trimethoxyphenyl)propan-1-ol (PubChem CID 162953882) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-methoxy-1-(2,4,5-trimethoxyphenyl)propan-1-ol.
| Compound Name | 2-methoxy-1-(2,4,5-trimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 162953882 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-methoxy-1-(2,4,5-trimethoxyphenyl)propan-1-ol |
| SMILES | COc1cc(OC)c(C(O)C(C)OC)cc1OC |
| InChI | InChI=1S/C13H20O5/c1-8(15-2)13(14)9-6-11(17-4)12(18-5)7-10(9)16-3/h6-8,13-14H,1-5H3 |
| InChIKey | ZBCZKGJBEMFBOW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |