C12H18O4 — CID 91567159
1,2,4-trimethoxy-5-(1-methoxyethyl)benzene (PubChem CID 91567159) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1,2,4-trimethoxy-5-(1-methoxyethyl)benzene.
| Compound Name | 1,2,4-trimethoxy-5-(1-methoxyethyl)benzene |
|---|---|
| PubChem CID | 91567159 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1,2,4-trimethoxy-5-(1-methoxyethyl)benzene |
| SMILES | COc1cc(OC)c(C(C)OC)cc1OC |
| InChI | InChI=1S/C12H18O4/c1-8(13-2)9-6-11(15-4)12(16-5)7-10(9)14-3/h6-8H,1-5H3 |
| InChIKey | DMXNDXQJVRPBGK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |