About 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene
7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene (PubChem CID 14427467) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene.
Molecular Properties
| Compound Name | 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene |
| PubChem CID | 14427467 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene |
| SMILES | COc1cc2c(cc1C(C)OC)C=CC(C)(C)O2 |
| InChI | InChI=1S/C15H20O3/c1-10(16-4)12-8-11-6-7-15(2,3)18-13(11)9-14(12)17-5/h6-10H,1-5H3 |
| InChIKey | KIDINSSIUWCEBX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene?
The IUPAC name of 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene (CID 14427467) is 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene.
What is the SMILES notation for 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene?
The canonical SMILES for 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene is COc1cc2c(cc1C(C)OC)C=CC(C)(C)O2.
What is the InChIKey of 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene?
The InChIKey is KIDINSSIUWCEBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-10(16-4)12-8-11-6-7-15(2,3)18-13(11)9-14(12)17-5/h6-10H,1-5H3.
What are the key properties of 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene?
7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene has a molecular weight of 248.32 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-6-(1-methoxyethyl)-2,2-dimethylchromene is sourced from PubChem (CID 14427467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).