C19H24O4 — CID 163186665
[(1S)-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl] (Z)-2-methylbut-2-enoate (PubChem CID 163186665) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(1S)-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S)-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163186665 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(1S)-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H](C)c1cc2c(cc1OC)OC(C)(C)C=C2 |
| InChI | InChI=1S/C19H24O4/c1-7-12(2)18(20)22-13(3)15-10-14-8-9-19(4,5)23-16(14)11-17(15)21-6/h7-11,13H,1-6H3/b12-7-/t13-/m0/s1 |
| InChIKey | LMQFQBUKMWFFNL-OTAKNEKHSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|