C14H23NO3 — CID 171246095
(1R)-2,2-dimethyl-1-(2,4,5-trimethoxyphenyl)propan-1-amine (PubChem CID 171246095) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-1-(2,4,5-trimethoxyphenyl)propan-1-amine.
| Compound Name | (1R)-2,2-dimethyl-1-(2,4,5-trimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171246095 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (1R)-2,2-dimethyl-1-(2,4,5-trimethoxyphenyl)propan-1-amine |
| SMILES | COc1cc(OC)c([C@H](N)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C14H23NO3/c1-14(2,3)13(15)9-7-11(17-5)12(18-6)8-10(9)16-4/h7-8,13H,15H2,1-6H3/t13-/m0/s1 |
| InChIKey | VHABVHYZNWDOQE-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |