C16H27NO4 — CID 171236802
(1R,3S)-3-amino-4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-ol (PubChem CID 171236802) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,3S)-3-amino-4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-ol.
| Compound Name | (1R,3S)-3-amino-4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 171236802 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (1R,3S)-3-amino-4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-ol |
| SMILES | COc1cc(OC)c([C@H](O)C[C@H](N)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C16H27NO4/c1-16(2,3)15(17)8-11(18)10-7-13(20-5)14(21-6)9-12(10)19-4/h7,9,11,15,18H,8,17H2,1-6H3/t11-,15+/m1/s1 |
| InChIKey | DRMCKPLMHWABAB-ABAIWWIYSA-N |
| XLogP | 2.51 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |