C15H25NO3 — CID 171237724
(1R,3R)-3-amino-1-(3,5-dimethoxyphenyl)-4,4-dimethylpentan-1-ol (PubChem CID 171237724) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (1R,3R)-3-amino-1-(3,5-dimethoxyphenyl)-4,4-dimethylpentan-1-ol.
| Compound Name | (1R,3R)-3-amino-1-(3,5-dimethoxyphenyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 171237724 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (1R,3R)-3-amino-1-(3,5-dimethoxyphenyl)-4,4-dimethylpentan-1-ol |
| SMILES | COc1cc(OC)cc([C@H](O)C[C@@H](N)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO3/c1-15(2,3)14(16)9-13(17)10-6-11(18-4)8-12(7-10)19-5/h6-8,13-14,17H,9,16H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | UHCNCQKXPZGSCB-ZIAGYGMSSA-N |
| XLogP | 2.50 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |