C11H16O4 — CID 79567115
1-(3,5-dimethoxyphenyl)-2-methoxyethanol (PubChem CID 79567115) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-methoxyethanol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-methoxyethanol |
|---|---|
| PubChem CID | 79567115 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-methoxyethanol |
| SMILES | COCC(O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C11H16O4/c1-13-7-11(12)8-4-9(14-2)6-10(5-8)15-3/h4-6,11-12H,7H2,1-3H3 |
| InChIKey | KLIRACCSKSNUOE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |