C14H20O3 — CID 115817579
1-(3,5-dimethoxyphenyl)-3-methylidenepentan-1-ol (PubChem CID 115817579) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-methylidenepentan-1-ol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-methylidenepentan-1-ol |
|---|---|
| PubChem CID | 115817579 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-methylidenepentan-1-ol |
| SMILES | C=C(CC)CC(O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H20O3/c1-5-10(2)6-14(15)11-7-12(16-3)9-13(8-11)17-4/h7-9,14-15H,2,5-6H2,1,3-4H3 |
| InChIKey | OZEGRYBEOWBLGO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|