C25H28N2O8S — CID 155545718
S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]propyl] 3,4,5-trimethoxybenzenecarbothioate (PubChem CID 155545718) has the molecular formula C25H28N2O8S and a molecular weight of 516.57 g/mol. Its IUPAC name is S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]propyl] 3,4,5-trimethoxybenzenecarbothioate.
| Compound Name | S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]propyl] 3,4,5-trimethoxybenzenecarbothioate |
|---|---|
| PubChem CID | 155545718 |
| Molecular Formula | C25H28N2O8S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | S-[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]propyl] 3,4,5-trimethoxybenzenecarbothioate |
| SMILES | CCC(SC(=O)c1cc(OC)c(OC)c(OC)c1)c1cc(OC)c2c(NO)ccc(N=O)c2c1OC |
| InChI | InChI=1S/C25H28N2O8S/c1-7-20(36-25(28)13-10-18(32-3)24(35-6)19(11-13)33-4)14-12-17(31-2)21-15(26-29)8-9-16(27-30)22(21)23(14)34-5/h8-12,20,26,29H,7H2,1-6H3 |
| InChIKey | LXOASEMSGNMZSA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|