C16H24N2O4 — CID 9231940
N-[(Z)-2-ethylbutylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 9231940) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(Z)-2-ethylbutylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-2-ethylbutylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 9231940 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[(Z)-2-ethylbutylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | CCC(/C=N\NC(=O)c1cc(OC)c(OC)c(OC)c1)CC |
| InChI | InChI=1S/C16H24N2O4/c1-6-11(7-2)10-17-18-16(19)12-8-13(20-3)15(22-5)14(9-12)21-4/h8-11H,6-7H2,1-5H3,(H,18,19)/b17-10- |
| InChIKey | HACMWFROMSSYBJ-YVLHZVERSA-N |
| XLogP | 2.86 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|